C24H28F6N2O7 — CID 155849121
(4aS,7S,7aR)-4-[(4,5-dimethylfuran-2-yl)methyl]-7-(pyridin-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155849121) has the molecular formula C24H28F6N2O7 and a molecular weight of 570.48 g/mol. Its IUPAC name is (4aS,7S,7aR)-4-[(4,5-dimethylfuran-2-yl)methyl]-7-(pyridin-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4aS,7S,7aR)-4-[(4,5-dimethylfuran-2-yl)methyl]-7-(pyridin-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155849121 |
| Molecular Formula | C24H28F6N2O7 |
| Molecular Weight | 570.48 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | (4aS,7S,7aR)-4-[(4,5-dimethylfuran-2-yl)methyl]-7-(pyridin-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cc(CN2CCO[C@H]3[C@@H](OCc4ccncc4)CC[C@@H]32)oc1C.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H26N2O3.2C2HF3O2/c1-14-11-17(25-15(14)2)12-22-9-10-23-20-18(22)3-4-19(20)24-13-16-5-7-21-8-6-16;2*3-2(4,5)1(6)7/h5-8,11,18-20H,3-4,9-10,12-13H2,1-2H3;2*(H,6,7)/t18-,19-,20+;;/m0../s1 |
| InChIKey | CBJYCCMBHOOSHJ-ZLARAOTRSA-N |
| XLogP | 4.51 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |