C22H24F6N2O7 — CID 155841790
(4aS,7S,7aR)-4-(furan-2-ylmethyl)-7-(pyridin-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155841790) has the molecular formula C22H24F6N2O7 and a molecular weight of 542.43 g/mol. Its IUPAC name is (4aS,7S,7aR)-4-(furan-2-ylmethyl)-7-(pyridin-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4aS,7S,7aR)-4-(furan-2-ylmethyl)-7-(pyridin-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155841790 |
| Molecular Formula | C22H24F6N2O7 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | (4aS,7S,7aR)-4-(furan-2-ylmethyl)-7-(pyridin-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1coc(CN2CCO[C@H]3[C@@H](OCc4ccncc4)CC[C@@H]32)c1 |
| InChI | InChI=1S/C18H22N2O3.2C2HF3O2/c1-2-15(21-10-1)12-20-9-11-22-18-16(20)3-4-17(18)23-13-14-5-7-19-8-6-14;2*3-2(4,5)1(6)7/h1-2,5-8,10,16-18H,3-4,9,11-13H2;2*(H,6,7)/t16-,17-,18+;;/m0../s1 |
| InChIKey | GESUMPQWZCETKZ-BGJJLSANSA-N |
| XLogP | 3.89 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |