C18H26N4O2 — CID 97470374
4-[[(2S,3R)-3-(2-methoxyethoxy)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-2-yl]methyl]pyridine (PubChem CID 97470374) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-[[(2S,3R)-3-(2-methoxyethoxy)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-2-yl]methyl]pyridine.
| Compound Name | 4-[[(2S,3R)-3-(2-methoxyethoxy)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-2-yl]methyl]pyridine |
|---|---|
| PubChem CID | 97470374 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 4-[[(2S,3R)-3-(2-methoxyethoxy)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-2-yl]methyl]pyridine |
| SMILES | COCCO[C@@H]1CCN(Cc2nccn2C)[C@H]1Cc1ccncc1 |
| InChI | InChI=1S/C18H26N4O2/c1-21-10-8-20-18(21)14-22-9-5-17(24-12-11-23-2)16(22)13-15-3-6-19-7-4-15/h3-4,6-8,10,16-17H,5,9,11-14H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | WUORKVLHSQWZQP-DLBZAZTESA-N |
| XLogP | 1.66 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|