C17H23N3 — CID 95595150
1-methyl-2-[[(2S)-2-(2-phenylethyl)pyrrolidin-1-yl]methyl]imidazole (PubChem CID 95595150) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 1-methyl-2-[[(2S)-2-(2-phenylethyl)pyrrolidin-1-yl]methyl]imidazole.
| Compound Name | 1-methyl-2-[[(2S)-2-(2-phenylethyl)pyrrolidin-1-yl]methyl]imidazole |
|---|---|
| PubChem CID | 95595150 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 1-methyl-2-[[(2S)-2-(2-phenylethyl)pyrrolidin-1-yl]methyl]imidazole |
| SMILES | Cn1ccnc1CN1CCC[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C17H23N3/c1-19-13-11-18-17(19)14-20-12-5-8-16(20)10-9-15-6-3-2-4-7-15/h2-4,6-7,11,13,16H,5,8-10,12,14H2,1H3/t16-/m1/s1 |
| InChIKey | PGKUAGNXBSYYSX-MRXNPFEDSA-N |
| XLogP | 3.02 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |