C20H27N3 — CID 95869234
2-ethyl-5-[[(2S)-2-(2-phenylethyl)piperidin-1-yl]methyl]pyrimidine (PubChem CID 95869234) has the molecular formula C20H27N3 and a molecular weight of 309.46 g/mol. Its IUPAC name is 2-ethyl-5-[[(2S)-2-(2-phenylethyl)piperidin-1-yl]methyl]pyrimidine.
| Compound Name | 2-ethyl-5-[[(2S)-2-(2-phenylethyl)piperidin-1-yl]methyl]pyrimidine |
|---|---|
| PubChem CID | 95869234 |
| Molecular Formula | C20H27N3 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 2-ethyl-5-[[(2S)-2-(2-phenylethyl)piperidin-1-yl]methyl]pyrimidine |
| SMILES | CCc1ncc(CN2CCCC[C@H]2CCc2ccccc2)cn1 |
| InChI | InChI=1S/C20H27N3/c1-2-20-21-14-18(15-22-20)16-23-13-7-6-10-19(23)12-11-17-8-4-3-5-9-17/h3-5,8-9,14-15,19H,2,6-7,10-13,16H2,1H3/t19-/m0/s1 |
| InChIKey | RQWBMCOQEHIQOU-IBGZPJMESA-N |
| XLogP | 4.03 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |