C19H25N3O2 — CID 164641718
3-[2-[(2R)-1-[(2-methoxypyrimidin-5-yl)methyl]piperidin-2-yl]ethyl]phenol (PubChem CID 164641718) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-[2-[(2R)-1-[(2-methoxypyrimidin-5-yl)methyl]piperidin-2-yl]ethyl]phenol.
| Compound Name | 3-[2-[(2R)-1-[(2-methoxypyrimidin-5-yl)methyl]piperidin-2-yl]ethyl]phenol |
|---|---|
| PubChem CID | 164641718 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 3-[2-[(2R)-1-[(2-methoxypyrimidin-5-yl)methyl]piperidin-2-yl]ethyl]phenol |
| SMILES | COc1ncc(CN2CCCC[C@@H]2CCc2cccc(O)c2)cn1 |
| InChI | InChI=1S/C19H25N3O2/c1-24-19-20-12-16(13-21-19)14-22-10-3-2-6-17(22)9-8-15-5-4-7-18(23)11-15/h4-5,7,11-13,17,23H,2-3,6,8-10,14H2,1H3/t17-/m1/s1 |
| InChIKey | YADOBTSXLDDCSA-QGZVFWFLSA-N |
| XLogP | 3.18 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |