C20H25N3O — CID 95706816
4-[[(2S)-2-[2-(3-hydroxyphenyl)ethyl]piperidin-1-yl]methyl]-1-methylpyrrole-2-carbonitrile (PubChem CID 95706816) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-[[(2S)-2-[2-(3-hydroxyphenyl)ethyl]piperidin-1-yl]methyl]-1-methylpyrrole-2-carbonitrile.
| Compound Name | 4-[[(2S)-2-[2-(3-hydroxyphenyl)ethyl]piperidin-1-yl]methyl]-1-methylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 95706816 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 4-[[(2S)-2-[2-(3-hydroxyphenyl)ethyl]piperidin-1-yl]methyl]-1-methylpyrrole-2-carbonitrile |
| SMILES | Cn1cc(CN2CCCC[C@H]2CCc2cccc(O)c2)cc1C#N |
| InChI | InChI=1S/C20H25N3O/c1-22-14-17(11-19(22)13-21)15-23-10-3-2-6-18(23)9-8-16-5-4-7-20(24)12-16/h4-5,7,11-12,14,18,24H,2-3,6,8-10,15H2,1H3/t18-/m0/s1 |
| InChIKey | QIFRQQUWCQXCBF-SFHVURJKSA-N |
| XLogP | 3.59 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |