C16H25NO2S — CID 97101388
(2S)-1-(2-methylsulfonylethyl)-2-(2-phenylethyl)piperidine (PubChem CID 97101388) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is (2S)-1-(2-methylsulfonylethyl)-2-(2-phenylethyl)piperidine.
| Compound Name | (2S)-1-(2-methylsulfonylethyl)-2-(2-phenylethyl)piperidine |
|---|---|
| PubChem CID | 97101388 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (2S)-1-(2-methylsulfonylethyl)-2-(2-phenylethyl)piperidine |
| SMILES | CS(=O)(=O)CCN1CCCC[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C16H25NO2S/c1-20(18,19)14-13-17-12-6-5-9-16(17)11-10-15-7-3-2-4-8-15/h2-4,7-8,16H,5-6,9-14H2,1H3/t16-/m0/s1 |
| InChIKey | VDAOQEKEGSIWKW-INIZCTEOSA-N |
| XLogP | 2.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |