C18H23NOS2 — CID 158700117
methylidene-oxo-[2-(2-phenylethyl)piperidin-1-yl]-thiophen-2-yl-λ6-sulfane (PubChem CID 158700117) has the molecular formula C18H23NOS2 and a molecular weight of 333.52 g/mol. Its IUPAC name is methylidene-oxo-[2-(2-phenylethyl)piperidin-1-yl]-thiophen-2-yl-λ6-sulfane.
| Compound Name | methylidene-oxo-[2-(2-phenylethyl)piperidin-1-yl]-thiophen-2-yl-λ6-sulfane |
|---|---|
| PubChem CID | 158700117 |
| Molecular Formula | C18H23NOS2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | methylidene-oxo-[2-(2-phenylethyl)piperidin-1-yl]-thiophen-2-yl-λ6-sulfane |
| SMILES | C=S(=O)(c1cccs1)N1CCCCC1CCc1ccccc1 |
| InChI | InChI=1S/C18H23NOS2/c1-22(20,18-11-7-15-21-18)19-14-6-5-10-17(19)13-12-16-8-3-2-4-9-16/h2-4,7-9,11,15,17H,1,5-6,10,12-14H2 |
| InChIKey | QUACTEDOLMFVPH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|