C14H22N2O4S3 — CID 121084159
N-[2-(1-thiophen-2-ylsulfonylpiperidin-2-yl)ethyl]cyclopropanesulfonamide (PubChem CID 121084159) has the molecular formula C14H22N2O4S3 and a molecular weight of 378.54 g/mol. Its IUPAC name is N-[2-(1-thiophen-2-ylsulfonylpiperidin-2-yl)ethyl]cyclopropanesulfonamide.
| Compound Name | N-[2-(1-thiophen-2-ylsulfonylpiperidin-2-yl)ethyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 121084159 |
| Molecular Formula | C14H22N2O4S3 |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-[2-(1-thiophen-2-ylsulfonylpiperidin-2-yl)ethyl]cyclopropanesulfonamide |
| SMILES | O=S(=O)(NCCC1CCCCN1S(=O)(=O)c1cccs1)C1CC1 |
| InChI | InChI=1S/C14H22N2O4S3/c17-22(18,13-6-7-13)15-9-8-12-4-1-2-10-16(12)23(19,20)14-5-3-11-21-14/h3,5,11-13,15H,1-2,4,6-10H2 |
| InChIKey | ZJUNVHPCPCSNLT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |