C21H26FN3O4S2 — CID 41195687
N'-[2-(4-fluorophenyl)ethyl]-N-[2-[(2S)-1-thiophen-2-ylsulfonylpiperidin-2-yl]ethyl]oxamide (PubChem CID 41195687) has the molecular formula C21H26FN3O4S2 and a molecular weight of 467.59 g/mol. Its IUPAC name is N'-[2-(4-fluorophenyl)ethyl]-N-[2-[(2S)-1-thiophen-2-ylsulfonylpiperidin-2-yl]ethyl]oxamide.
| Compound Name | N'-[2-(4-fluorophenyl)ethyl]-N-[2-[(2S)-1-thiophen-2-ylsulfonylpiperidin-2-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 41195687 |
| Molecular Formula | C21H26FN3O4S2 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N'-[2-(4-fluorophenyl)ethyl]-N-[2-[(2S)-1-thiophen-2-ylsulfonylpiperidin-2-yl]ethyl]oxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)C(=O)NCC[C@@H]1CCCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C21H26FN3O4S2/c22-17-8-6-16(7-9-17)10-12-23-20(26)21(27)24-13-11-18-4-1-2-14-25(18)31(28,29)19-5-3-15-30-19/h3,5-9,15,18H,1-2,4,10-14H2,(H,23,26)(H,24,27)/t18-/m0/s1 |
| InChIKey | MOXDCOHRAKKYSS-SFHVURJKSA-N |
| XLogP | 2.30 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|