C20H23N3O4S3 — CID 121084164
N-[2-(1-thiophen-2-ylsulfonylpiperidin-2-yl)ethyl]quinoline-8-sulfonamide (PubChem CID 121084164) has the molecular formula C20H23N3O4S3 and a molecular weight of 465.62 g/mol. Its IUPAC name is N-[2-(1-thiophen-2-ylsulfonylpiperidin-2-yl)ethyl]quinoline-8-sulfonamide.
| Compound Name | N-[2-(1-thiophen-2-ylsulfonylpiperidin-2-yl)ethyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 121084164 |
| Molecular Formula | C20H23N3O4S3 |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | N-[2-(1-thiophen-2-ylsulfonylpiperidin-2-yl)ethyl]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(NCCC1CCCCN1S(=O)(=O)c1cccs1)c1cccc2cccnc12 |
| InChI | InChI=1S/C20H23N3O4S3/c24-29(25,18-9-3-6-16-7-4-12-21-20(16)18)22-13-11-17-8-1-2-14-23(17)30(26,27)19-10-5-15-28-19/h3-7,9-10,12,15,17,22H,1-2,8,11,13-14H2 |
| InChIKey | CPZNUFZXIIABEL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |