C15H21NO3S — CID 97391960
(2S,3S)-2-benzyl-1-cyclopropylsulfonyl-3-methoxypyrrolidine (PubChem CID 97391960) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is (2S,3S)-2-benzyl-1-cyclopropylsulfonyl-3-methoxypyrrolidine.
| Compound Name | (2S,3S)-2-benzyl-1-cyclopropylsulfonyl-3-methoxypyrrolidine |
|---|---|
| PubChem CID | 97391960 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (2S,3S)-2-benzyl-1-cyclopropylsulfonyl-3-methoxypyrrolidine |
| SMILES | CO[C@H]1CCN(S(=O)(=O)C2CC2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO3S/c1-19-15-9-10-16(20(17,18)13-7-8-13)14(15)11-12-5-3-2-4-6-12/h2-6,13-15H,7-11H2,1H3/t14-,15-/m0/s1 |
| InChIKey | MILVIDAFUDAIDE-GJZGRUSLSA-N |
| XLogP | 1.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |