C23H29NO3 — CID 97406726
[(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(3,5-dimethylphenyl)methanone (PubChem CID 97406726) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(3,5-dimethylphenyl)methanone.
| Compound Name | [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(3,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 97406726 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(3,5-dimethylphenyl)methanone |
| SMILES | COCCO[C@@H]1CCN(C(=O)c2cc(C)cc(C)c2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO3/c1-17-13-18(2)15-20(14-17)23(25)24-10-9-22(27-12-11-26-3)21(24)16-19-7-5-4-6-8-19/h4-8,13-15,21-22H,9-12,16H2,1-3H3/t21-,22+/m0/s1 |
| InChIKey | UFCUIIPZZZBFDZ-FCHUYYIVSA-N |
| XLogP | 3.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|