C16H18N2O2 — CID 131688110
[(2S,3S)-2-benzyl-3-hydroxypyrrolidin-1-yl]-(1H-pyrrol-3-yl)methanone (PubChem CID 131688110) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is [(2S,3S)-2-benzyl-3-hydroxypyrrolidin-1-yl]-(1H-pyrrol-3-yl)methanone.
| Compound Name | [(2S,3S)-2-benzyl-3-hydroxypyrrolidin-1-yl]-(1H-pyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 131688110 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | [(2S,3S)-2-benzyl-3-hydroxypyrrolidin-1-yl]-(1H-pyrrol-3-yl)methanone |
| SMILES | O=C(c1cc[nH]c1)N1CC[C@H](O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C16H18N2O2/c19-15-7-9-18(16(20)13-6-8-17-11-13)14(15)10-12-4-2-1-3-5-12/h1-6,8,11,14-15,17,19H,7,9-10H2/t14-,15-/m0/s1 |
| InChIKey | SKOLVLGSXUDDHP-GJZGRUSLSA-N |
| XLogP | 1.83 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |