C20H20N2O2 — CID 97470101
[(2S,3R)-2-benzyl-3-hydroxypyrrolidin-1-yl]-(1H-indol-5-yl)methanone (PubChem CID 97470101) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is [(2S,3R)-2-benzyl-3-hydroxypyrrolidin-1-yl]-(1H-indol-5-yl)methanone.
| Compound Name | [(2S,3R)-2-benzyl-3-hydroxypyrrolidin-1-yl]-(1H-indol-5-yl)methanone |
|---|---|
| PubChem CID | 97470101 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | [(2S,3R)-2-benzyl-3-hydroxypyrrolidin-1-yl]-(1H-indol-5-yl)methanone |
| SMILES | O=C(c1ccc2[nH]ccc2c1)N1CC[C@@H](O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H20N2O2/c23-19-9-11-22(18(19)12-14-4-2-1-3-5-14)20(24)16-6-7-17-15(13-16)8-10-21-17/h1-8,10,13,18-19,21,23H,9,11-12H2/t18-,19+/m0/s1 |
| InChIKey | SSWDJTIIXDHRPW-RBUKOAKNSA-N |
| XLogP | 2.99 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |