C21H24FN3O — CID 174396061
(4-ethylpiperazin-1-yl)-(1H-indol-5-yl)methanone;fluorobenzene (PubChem CID 174396061) has the molecular formula C21H24FN3O and a molecular weight of 353.44 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-(1H-indol-5-yl)methanone;fluorobenzene.
| Compound Name | (4-ethylpiperazin-1-yl)-(1H-indol-5-yl)methanone;fluorobenzene |
|---|---|
| PubChem CID | 174396061 |
| Molecular Formula | C21H24FN3O |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-(1H-indol-5-yl)methanone;fluorobenzene |
| SMILES | CCN1CCN(C(=O)c2ccc3[nH]ccc3c2)CC1.Fc1ccccc1 |
| InChI | InChI=1S/C15H19N3O.C6H5F/c1-2-17-7-9-18(10-8-17)15(19)13-3-4-14-12(11-13)5-6-16-14;7-6-4-2-1-3-5-6/h3-6,11,16H,2,7-10H2,1H3;1-5H |
| InChIKey | IZLSFHSOEYCFNZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |