C20H22N4O2 — CID 53185116
1H-indol-5-yl-[4-[(6-methoxy-3-pyridinyl)methyl]piperazin-1-yl]methanone (PubChem CID 53185116) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1H-indol-5-yl-[4-[(6-methoxy-3-pyridinyl)methyl]piperazin-1-yl]methanone.
| Compound Name | 1H-indol-5-yl-[4-[(6-methoxy-3-pyridinyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 53185116 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1H-indol-5-yl-[4-[(6-methoxy-3-pyridinyl)methyl]piperazin-1-yl]methanone |
| SMILES | COc1ccc(CN2CCN(C(=O)c3ccc4[nH]ccc4c3)CC2)cn1 |
| InChI | InChI=1S/C20H22N4O2/c1-26-19-5-2-15(13-22-19)14-23-8-10-24(11-9-23)20(25)17-3-4-18-16(12-17)6-7-21-18/h2-7,12-13,21H,8-11,14H2,1H3 |
| InChIKey | PSFQEDMWMROGOH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |