C22H22N2O4 — CID 164699959
(3R,4S)-3-benzyl-4-hydroxy-1-(1H-indole-5-carbonyl)piperidine-3-carboxylic acid (PubChem CID 164699959) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is (3R,4S)-3-benzyl-4-hydroxy-1-(1H-indole-5-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-benzyl-4-hydroxy-1-(1H-indole-5-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164699959 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (3R,4S)-3-benzyl-4-hydroxy-1-(1H-indole-5-carbonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(c1ccc2[nH]ccc2c1)N1CC[C@H](O)[C@](Cc2ccccc2)(C(=O)O)C1 |
| InChI | InChI=1S/C22H22N2O4/c25-19-9-11-24(20(26)17-6-7-18-16(12-17)8-10-23-18)14-22(19,21(27)28)13-15-4-2-1-3-5-15/h1-8,10,12,19,23,25H,9,11,13-14H2,(H,27,28)/t19-,22+/m0/s1 |
| InChIKey | HKOXZWGBKAMWTO-SIKLNZKXSA-N |
| XLogP | 2.69 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |