C11H15NO3 — CID 102738155
furan-3-yl-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone (PubChem CID 102738155) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is furan-3-yl-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone.
| Compound Name | furan-3-yl-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 102738155 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | furan-3-yl-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone |
| SMILES | CC1CCN(C(=O)c2ccoc2)C1CO |
| InChI | InChI=1S/C11H15NO3/c1-8-2-4-12(10(8)6-13)11(14)9-3-5-15-7-9/h3,5,7-8,10,13H,2,4,6H2,1H3 |
| InChIKey | NXFMCTAASXZKMI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |