C12H15BN2O3S — CID 155730317
CID 155730317 (PubChem CID 155730317) has the molecular formula C12H15BN2O3S and a molecular weight of 278.14 g/mol.
| Compound Name | CID 155730317 |
|---|---|
| PubChem CID | 155730317 |
| Molecular Formula | C12H15BN2O3S |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)C2CCN(S(C)(=O)=O)CC2)cn1 |
| InChI | InChI=1S/C12H15BN2O3S/c1-19(17,18)15-6-4-9(5-7-15)12(16)10-2-3-11(13)14-8-10/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | VAKKULGGDARJIL-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|