C16H22N2O2 — CID 131683967
[(2R,3aS,7aS)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(6-ethyl-3-pyridinyl)methanone (PubChem CID 131683967) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is [(2R,3aS,7aS)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(6-ethyl-3-pyridinyl)methanone.
| Compound Name | [(2R,3aS,7aS)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(6-ethyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 131683967 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | [(2R,3aS,7aS)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(6-ethyl-3-pyridinyl)methanone |
| SMILES | CCc1ccc(C(=O)N2CC[C@H]3C[C@@H](C)O[C@@H]3C2)cn1 |
| InChI | InChI=1S/C16H22N2O2/c1-3-14-5-4-13(9-17-14)16(19)18-7-6-12-8-11(2)20-15(12)10-18/h4-5,9,11-12,15H,3,6-8,10H2,1-2H3/t11-,12+,15-/m1/s1 |
| InChIKey | SDTMLZSGRQYFLQ-TYNCELHUSA-N |
| XLogP | 2.28 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |