About 1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate
1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate (PubChem CID 87283400) has the molecular formula C10H8N2O6
and a molecular weight of 252.18 g/mol. Its IUPAC name is 1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate.
Molecular Properties
| Compound Name | 1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate |
| PubChem CID | 87283400 |
| Molecular Formula | C10H8N2O6 |
| Molecular Weight | 252.18 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate |
| SMILES | CC(=O)ON1C(=O)CCC1=O.O=C1C=C2C(=O)N12 |
| InChI | InChI=1S/C6H7NO4.C4HNO2/c1-4(8)11-7-5(9)2-3-6(7)10;6-3-1-2-4(7)5(2)3/h2-3H2,1H3;1H |
| InChIKey | IGHKIODRLNWYPL-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.18 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate?
The IUPAC name of 1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate (CID 87283400) is 1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate.
What is the SMILES notation for 1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate?
The canonical SMILES for 1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate is CC(=O)ON1C(=O)CCC1=O.O=C1C=C2C(=O)N12.
What is the InChIKey of 1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate?
The InChIKey is IGHKIODRLNWYPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO4.C4HNO2/c1-4(8)11-7-5(9)2-3-6(7)10;6-3-1-2-4(7)5(2)3/h2-3H2,1H3;1H.
What are the key properties of 1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate?
1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate has a molecular weight of 252.18 g/mol, XLogP of -1.13, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.1.0]pent-3-ene-2,5-dione;(2,5-dioxopyrrolidin-1-yl) acetate is sourced from PubChem (CID 87283400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).