C20H27N3O4 — CID 71744661
(2,5-dioxopyrrolidin-1-yl) N-[(4-piperidin-1-ylphenyl)methyl]-N-propylcarbamate (PubChem CID 71744661) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-[(4-piperidin-1-ylphenyl)methyl]-N-propylcarbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-[(4-piperidin-1-ylphenyl)methyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 71744661 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-[(4-piperidin-1-ylphenyl)methyl]-N-propylcarbamate |
| SMILES | CCCN(Cc1ccc(N2CCCCC2)cc1)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H27N3O4/c1-2-12-22(20(26)27-23-18(24)10-11-19(23)25)15-16-6-8-17(9-7-16)21-13-4-3-5-14-21/h6-9H,2-5,10-15H2,1H3 |
| InChIKey | SOOYXTCIQMLHRY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|