C5H7N3O3 — CID 19742634
(2,5-dioxopyrrolidin-1-yl) carbamimidate (PubChem CID 19742634) has the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) carbamimidate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) carbamimidate |
|---|---|
| PubChem CID | 19742634 |
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) carbamimidate |
| SMILES | [H]/N=C(\N)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C5H7N3O3/c6-5(7)11-8-3(9)1-2-4(8)10/h1-2H2,(H3,6,7) |
| InChIKey | QGJDBQYUNSLVFB-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|