C14H14N2O6S — CID 101232198
(2,5-dioxopyrrolidin-1-yl) 4-[(ethenylsulfonylamino)methyl]benzoate (PubChem CID 101232198) has the molecular formula C14H14N2O6S and a molecular weight of 338.34 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[(ethenylsulfonylamino)methyl]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[(ethenylsulfonylamino)methyl]benzoate |
|---|---|
| PubChem CID | 101232198 |
| Molecular Formula | C14H14N2O6S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[(ethenylsulfonylamino)methyl]benzoate |
| SMILES | C=CS(=O)(=O)NCc1ccc(C(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C14H14N2O6S/c1-2-23(20,21)15-9-10-3-5-11(6-4-10)14(19)22-16-12(17)7-8-13(16)18/h2-6,15H,1,7-9H2 |
| InChIKey | OZCIUWKQRPTSEB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|