C15H12N4O5 — CID 162427093
(2,5-dioxopyrrolidin-1-yl) 4-[(4-formyltriazol-1-yl)methyl]benzoate (PubChem CID 162427093) has the molecular formula C15H12N4O5 and a molecular weight of 328.28 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[(4-formyltriazol-1-yl)methyl]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[(4-formyltriazol-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 162427093 |
| Molecular Formula | C15H12N4O5 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[(4-formyltriazol-1-yl)methyl]benzoate |
| SMILES | O=Cc1cn(Cc2ccc(C(=O)ON3C(=O)CCC3=O)cc2)nn1 |
| InChI | InChI=1S/C15H12N4O5/c20-9-12-8-18(17-16-12)7-10-1-3-11(4-2-10)15(23)24-19-13(21)5-6-14(19)22/h1-4,8-9H,5-7H2 |
| InChIKey | JDWPHXCKJPLOMT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|