C16H12F3N3O4 — CID 170758594
(2,5-dioxopyrrolidin-1-yl) 1-[[4-(trifluoromethyl)phenyl]methyl]pyrazole-4-carboxylate (PubChem CID 170758594) has the molecular formula C16H12F3N3O4 and a molecular weight of 367.28 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 1-[[4-(trifluoromethyl)phenyl]methyl]pyrazole-4-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 1-[[4-(trifluoromethyl)phenyl]methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 170758594 |
| Molecular Formula | C16H12F3N3O4 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 1-[[4-(trifluoromethyl)phenyl]methyl]pyrazole-4-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1cnn(Cc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C16H12F3N3O4/c17-16(18,19)12-3-1-10(2-4-12)8-21-9-11(7-20-21)15(25)26-22-13(23)5-6-14(22)24/h1-4,7,9H,5-6,8H2 |
| InChIKey | MBUIUDQDFAIJCG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|