C16H16N4O3 — CID 141321250
1-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]methyl]pyrazole-4-carboxamide (PubChem CID 141321250) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 1-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]methyl]pyrazole-4-carboxamide.
| Compound Name | 1-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 141321250 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]methyl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(Cc2ccc(CN3C(=O)CCC3=O)cc2)c1 |
| InChI | InChI=1S/C16H16N4O3/c17-16(23)13-7-18-19(10-13)8-11-1-3-12(4-2-11)9-20-14(21)5-6-15(20)22/h1-4,7,10H,5-6,8-9H2,(H2,17,23) |
| InChIKey | PQRBHZFGHRYONT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|