C19H19F3N4O2 — CID 170758635
7-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazole-4-carbonyl]-2,7-diazaspiro[3.4]octane-2-carbaldehyde (PubChem CID 170758635) has the molecular formula C19H19F3N4O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is 7-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazole-4-carbonyl]-2,7-diazaspiro[3.4]octane-2-carbaldehyde.
| Compound Name | 7-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazole-4-carbonyl]-2,7-diazaspiro[3.4]octane-2-carbaldehyde |
|---|---|
| PubChem CID | 170758635 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 7-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazole-4-carbonyl]-2,7-diazaspiro[3.4]octane-2-carbaldehyde |
| SMILES | O=CN1CC2(CCN(C(=O)c3cnn(Cc4ccc(C(F)(F)F)cc4)c3)C2)C1 |
| InChI | InChI=1S/C19H19F3N4O2/c20-19(21,22)16-3-1-14(2-4-16)8-26-9-15(7-23-26)17(28)25-6-5-18(12-25)10-24(11-18)13-27/h1-4,7,9,13H,5-6,8,10-12H2 |
| InChIKey | VMFDNQIHQOWBJH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|