C22H23F5N4O2 — CID 170757688
1-[7-[1-[(3,4-difluorophenyl)methyl]pyrazole-4-carbonyl]-2,7-diazaspiro[3.4]octan-2-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-one (PubChem CID 170757688) has the molecular formula C22H23F5N4O2 and a molecular weight of 470.44 g/mol. Its IUPAC name is 1-[7-[1-[(3,4-difluorophenyl)methyl]pyrazole-4-carbonyl]-2,7-diazaspiro[3.4]octan-2-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-one.
| Compound Name | 1-[7-[1-[(3,4-difluorophenyl)methyl]pyrazole-4-carbonyl]-2,7-diazaspiro[3.4]octan-2-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 170757688 |
| Molecular Formula | C22H23F5N4O2 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 1-[7-[1-[(3,4-difluorophenyl)methyl]pyrazole-4-carbonyl]-2,7-diazaspiro[3.4]octan-2-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C(=O)N1CC2(CCN(C(=O)c3cnn(Cc4ccc(F)c(F)c4)c3)C2)C1)C(F)(F)F |
| InChI | InChI=1S/C22H23F5N4O2/c1-20(2,22(25,26)27)19(33)30-12-21(13-30)5-6-29(11-21)18(32)15-8-28-31(10-15)9-14-3-4-16(23)17(24)7-14/h3-4,7-8,10H,5-6,9,11-13H2,1-2H3 |
| InChIKey | UYGJAGWNQYZRRC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |