C19H20N4O4 — CID 170759086
2-[[4-(2-formyl-2,7-diazaspiro[3.4]octane-7-carbonyl)pyrazol-1-yl]methyl]benzoic acid (PubChem CID 170759086) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-[[4-(2-formyl-2,7-diazaspiro[3.4]octane-7-carbonyl)pyrazol-1-yl]methyl]benzoic acid.
| Compound Name | 2-[[4-(2-formyl-2,7-diazaspiro[3.4]octane-7-carbonyl)pyrazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 170759086 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-[[4-(2-formyl-2,7-diazaspiro[3.4]octane-7-carbonyl)pyrazol-1-yl]methyl]benzoic acid |
| SMILES | O=CN1CC2(CCN(C(=O)c3cnn(Cc4ccccc4C(=O)O)c3)C2)C1 |
| InChI | InChI=1S/C19H20N4O4/c24-13-21-10-19(11-21)5-6-22(12-19)17(25)15-7-20-23(9-15)8-14-3-1-2-4-16(14)18(26)27/h1-4,7,9,13H,5-6,8,10-12H2,(H,26,27) |
| InChIKey | PUXHZDITLXCGOD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|