C16H19N3O7S — CID 177025196
(2,5-dioxopyrrolidin-1-yl) 4-(5-aminopentanoylsulfamoyl)benzoate (PubChem CID 177025196) has the molecular formula C16H19N3O7S and a molecular weight of 397.41 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(5-aminopentanoylsulfamoyl)benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(5-aminopentanoylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 177025196 |
| Molecular Formula | C16H19N3O7S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(5-aminopentanoylsulfamoyl)benzoate |
| SMILES | NCCCCC(=O)NS(=O)(=O)c1ccc(C(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C16H19N3O7S/c17-10-2-1-3-13(20)18-27(24,25)12-6-4-11(5-7-12)16(23)26-19-14(21)8-9-15(19)22/h4-7H,1-3,8-10,17H2,(H,18,20) |
| InChIKey | LFVTUDXETKWLJE-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|