C10H20O3S — CID 66025467
2-(1,1-dioxothiolan-3-yl)-2-methylpentan-1-ol (PubChem CID 66025467) has the molecular formula C10H20O3S and a molecular weight of 220.33 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-methylpentan-1-ol.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 66025467 |
| Molecular Formula | C10H20O3S |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-methylpentan-1-ol |
| SMILES | CCCC(C)(CO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H20O3S/c1-3-5-10(2,8-11)9-4-6-14(12,13)7-9/h9,11H,3-8H2,1-2H3 |
| InChIKey | WMPIBTNZHZYEEU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |