C14H28O2S — CID 130320648
4-(2-methyloctan-2-yl)thiane 1,1-dioxide (PubChem CID 130320648) has the molecular formula C14H28O2S and a molecular weight of 260.44 g/mol. Its IUPAC name is 4-(2-methyloctan-2-yl)thiane 1,1-dioxide.
| Compound Name | 4-(2-methyloctan-2-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 130320648 |
| Molecular Formula | C14H28O2S |
| Molecular Weight | 260.44 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 4-(2-methyloctan-2-yl)thiane 1,1-dioxide |
| SMILES | CCCCCCC(C)(C)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H28O2S/c1-4-5-6-7-10-14(2,3)13-8-11-17(15,16)12-9-13/h13H,4-12H2,1-3H3 |
| InChIKey | ACSDSRKFNDVFRE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|