C14H29NO2S — CID 138503013
4-(3-methylnonan-3-yl)-1,4-thiazinane 1,1-dioxide (PubChem CID 138503013) has the molecular formula C14H29NO2S and a molecular weight of 275.46 g/mol. Its IUPAC name is 4-(3-methylnonan-3-yl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(3-methylnonan-3-yl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 138503013 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 4-(3-methylnonan-3-yl)-1,4-thiazinane 1,1-dioxide |
| SMILES | CCCCCCC(C)(CC)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H29NO2S/c1-4-6-7-8-9-14(3,5-2)15-10-12-18(16,17)13-11-15/h4-13H2,1-3H3 |
| InChIKey | PXROBNZQJHEOTB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|