C9H19NO3S — CID 104549673
2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-1-ol (PubChem CID 104549673) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-1-ol.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 104549673 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-1-ol |
| SMILES | CCC(C)(CO)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H19NO3S/c1-3-9(2,8-11)10-4-6-14(12,13)7-5-10/h11H,3-8H2,1-2H3 |
| InChIKey | XVLRQCNTSBKFNM-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |