C12H25NO2S — CID 139320074
4-(3-methylheptan-3-yl)-1,4-thiazinane 1,1-dioxide (PubChem CID 139320074) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is 4-(3-methylheptan-3-yl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(3-methylheptan-3-yl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 139320074 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 4-(3-methylheptan-3-yl)-1,4-thiazinane 1,1-dioxide |
| SMILES | CCCCC(C)(CC)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H25NO2S/c1-4-6-7-12(3,5-2)13-8-10-16(14,15)11-9-13/h4-11H2,1-3H3 |
| InChIKey | JXWDQBODZHFGRU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |