C17H35NO4S2 — CID 126694881
4-(5-methyldodecan-5-ylsulfonyl)-1,4-thiazinane 1,1-dioxide (PubChem CID 126694881) has the molecular formula C17H35NO4S2 and a molecular weight of 381.60 g/mol. Its IUPAC name is 4-(5-methyldodecan-5-ylsulfonyl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(5-methyldodecan-5-ylsulfonyl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 126694881 |
| Molecular Formula | C17H35NO4S2 |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 4-(5-methyldodecan-5-ylsulfonyl)-1,4-thiazinane 1,1-dioxide |
| SMILES | CCCCCCCC(C)(CCCC)S(=O)(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C17H35NO4S2/c1-4-6-8-9-10-12-17(3,11-7-5-2)24(21,22)18-13-15-23(19,20)16-14-18/h4-16H2,1-3H3 |
| InChIKey | YVQAWJRQXKUBSF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|