About 1-butylsulfonylbutane;thiolane 1,1-dioxide
1-butylsulfonylbutane;thiolane 1,1-dioxide (PubChem CID 170346505) has the molecular formula C12H26O4S2
and a molecular weight of 298.47 g/mol. Its IUPAC name is 1-butylsulfonylbutane;thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 1-butylsulfonylbutane;thiolane 1,1-dioxide |
| PubChem CID | 170346505 |
| Molecular Formula | C12H26O4S2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 1-butylsulfonylbutane;thiolane 1,1-dioxide |
| SMILES | CCCCS(=O)(=O)CCCC.O=S1(=O)CCCC1 |
| InChI | InChI=1S/C8H18O2S.C4H8O2S/c1-3-5-7-11(9,10)8-6-4-2;5-7(6)3-1-2-4-7/h3-8H2,1-2H3;1-4H2 |
| InChIKey | ORJMXIFAMAOAPH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butylsulfonylbutane;thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylsulfonylbutane;thiolane 1,1-dioxide?
The IUPAC name of 1-butylsulfonylbutane;thiolane 1,1-dioxide (CID 170346505) is 1-butylsulfonylbutane;thiolane 1,1-dioxide.
What is the SMILES notation for 1-butylsulfonylbutane;thiolane 1,1-dioxide?
The canonical SMILES for 1-butylsulfonylbutane;thiolane 1,1-dioxide is CCCCS(=O)(=O)CCCC.O=S1(=O)CCCC1.
What is the InChIKey of 1-butylsulfonylbutane;thiolane 1,1-dioxide?
The InChIKey is ORJMXIFAMAOAPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2S.C4H8O2S/c1-3-5-7-11(9,10)8-6-4-2;5-7(6)3-1-2-4-7/h3-8H2,1-2H3;1-4H2.
What are the key properties of 1-butylsulfonylbutane;thiolane 1,1-dioxide?
1-butylsulfonylbutane;thiolane 1,1-dioxide has a molecular weight of 298.47 g/mol, XLogP of 2.20, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylsulfonylbutane;thiolane 1,1-dioxide is sourced from PubChem (CID 170346505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).