C13H30O4S2 — CID 162069522
ethane;thiane 1,1-dioxide;thiolane 1,1-dioxide (PubChem CID 162069522) has the molecular formula C13H30O4S2 and a molecular weight of 314.51 g/mol. Its IUPAC name is ethane;thiane 1,1-dioxide;thiolane 1,1-dioxide.
| Compound Name | ethane;thiane 1,1-dioxide;thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 162069522 |
| Molecular Formula | C13H30O4S2 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | ethane;thiane 1,1-dioxide;thiolane 1,1-dioxide |
| SMILES | CC.CC.O=S1(=O)CCCC1.O=S1(=O)CCCCC1 |
| InChI | InChI=1S/C5H10O2S.C4H8O2S.2C2H6/c6-8(7)4-2-1-3-5-8;5-7(6)3-1-2-4-7;2*1-2/h1-5H2;1-4H2;2*1-2H3 |
| InChIKey | ZAWUCPCINWIZBO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |