C14H30O6S2 — CID 58676689
1-[2-[2-(2-butylsulfonylethoxy)ethoxy]ethylsulfonyl]butane (PubChem CID 58676689) has the molecular formula C14H30O6S2 and a molecular weight of 358.52 g/mol. Its IUPAC name is 1-[2-[2-(2-butylsulfonylethoxy)ethoxy]ethylsulfonyl]butane.
| Compound Name | 1-[2-[2-(2-butylsulfonylethoxy)ethoxy]ethylsulfonyl]butane |
|---|---|
| PubChem CID | 58676689 |
| Molecular Formula | C14H30O6S2 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[2-[2-(2-butylsulfonylethoxy)ethoxy]ethylsulfonyl]butane |
| SMILES | CCCCS(=O)(=O)CCOCCOCCS(=O)(=O)CCCC |
| InChI | InChI=1S/C14H30O6S2/c1-3-5-11-21(15,16)13-9-19-7-8-20-10-14-22(17,18)12-6-4-2/h3-14H2,1-2H3 |
| InChIKey | JAZBAZMEKBOSHU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|