About sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane
sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane (PubChem CID 142757294) has the molecular formula C7H15NaO5S3
and a molecular weight of 298.38 g/mol. Its IUPAC name is sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane.
Molecular Properties
| Compound Name | sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane |
| PubChem CID | 142757294 |
| Molecular Formula | C7H15NaO5S3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane |
| SMILES | CCCCCS(=O)(=O)CCOS(=O)([O-])=S.[Na+] |
| InChI | InChI=1S/C7H16O5S3.Na/c1-2-3-4-6-14(8,9)7-5-12-15(10,11)13;/h2-7H2,1H3,(H,10,11,13);/q;+1/p-1 |
| InChIKey | JJTJIFBWBMNYMP-UHFFFAOYSA-M |
| XLogP | -2.60 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane?
The IUPAC name of sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane (CID 142757294) is sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane.
What is the SMILES notation for sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane?
The canonical SMILES for sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane is CCCCCS(=O)(=O)CCOS(=O)([O-])=S.[Na+].
What is the InChIKey of sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane?
The InChIKey is JJTJIFBWBMNYMP-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H16O5S3.Na/c1-2-3-4-6-14(8,9)7-5-12-15(10,11)13;/h2-7H2,1H3,(H,10,11,13);/q;+1/p-1.
What are the key properties of sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane?
sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane has a molecular weight of 298.38 g/mol, XLogP of -2.60, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium oxido-oxo-(2-pentylsulfonylethoxy)-sulfanylidene-λ6-sulfane is sourced from PubChem (CID 142757294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).