C6H12CoO6S4 — CID 86740778
cobalt(2+);oxido-(6-oxidosulfonothioyloxyhexoxy)-oxo-sulfanylidene-λ6-sulfane (PubChem CID 86740778) has the molecular formula C6H12CoO6S4 and a molecular weight of 367.36 g/mol. Its IUPAC name is cobalt(2+);oxido-(6-oxidosulfonothioyloxyhexoxy)-oxo-sulfanylidene-λ6-sulfane.
| Compound Name | cobalt(2+);oxido-(6-oxidosulfonothioyloxyhexoxy)-oxo-sulfanylidene-λ6-sulfane |
|---|---|
| PubChem CID | 86740778 |
| Molecular Formula | C6H12CoO6S4 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 366.88 |
| IUPAC Name | cobalt(2+);oxido-(6-oxidosulfonothioyloxyhexoxy)-oxo-sulfanylidene-λ6-sulfane |
| SMILES | O=S([O-])(=S)OCCCCCCOS(=O)([O-])=S.[Co+2] |
| InChI | InChI=1S/C6H14O6S4.Co/c7-15(8,13)11-5-3-1-2-4-6-12-16(9,10)14;/h1-6H2,(H,7,8,13)(H,9,10,14);/q;+2/p-2 |
| InChIKey | IEIUMDFBYFYSEG-UHFFFAOYSA-L |
| XLogP | 0.16 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|