C13H18NNaO4S2 — CID 23690128
sodium N-(6-oxidosulfonothioyloxyhexyl)benzamide (PubChem CID 23690128) has the molecular formula C13H18NNaO4S2 and a molecular weight of 339.41 g/mol. Its IUPAC name is sodium N-(6-oxidosulfonothioyloxyhexyl)benzamide.
| Compound Name | sodium N-(6-oxidosulfonothioyloxyhexyl)benzamide |
|---|---|
| PubChem CID | 23690128 |
| Molecular Formula | C13H18NNaO4S2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | sodium N-(6-oxidosulfonothioyloxyhexyl)benzamide |
| SMILES | O=C(NCCCCCCOS(=O)([O-])=S)c1ccccc1.[Na+] |
| InChI | InChI=1S/C13H19NO4S2.Na/c15-13(12-8-4-3-5-9-12)14-10-6-1-2-7-11-18-20(16,17)19;/h3-5,8-9H,1-2,6-7,10-11H2,(H,14,15)(H,16,17,19);/q;+1/p-1 |
| InChIKey | XSYVEAAVIYKCJK-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|