C19H23N2NaO5S — CID 24840049
sodium [4-(5-benzamidopentoxy)anilino]methanesulfonate (PubChem CID 24840049) has the molecular formula C19H23N2NaO5S and a molecular weight of 414.46 g/mol. Its IUPAC name is sodium [4-(5-benzamidopentoxy)anilino]methanesulfonate.
| Compound Name | sodium [4-(5-benzamidopentoxy)anilino]methanesulfonate |
|---|---|
| PubChem CID | 24840049 |
| Molecular Formula | C19H23N2NaO5S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | sodium [4-(5-benzamidopentoxy)anilino]methanesulfonate |
| SMILES | O=C(NCCCCCOc1ccc(NCS(=O)(=O)[O-])cc1)c1ccccc1.[Na+] |
| InChI | InChI=1S/C19H24N2O5S.Na/c22-19(16-7-3-1-4-8-16)20-13-5-2-6-14-26-18-11-9-17(10-12-18)21-15-27(23,24)25;/h1,3-4,7-12,21H,2,5-6,13-15H2,(H,20,22)(H,23,24,25);/q;+1/p-1 |
| InChIKey | UCKHWFWTBSYUBW-UHFFFAOYSA-M |
| XLogP | -0.42 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|