C24H26NO4P — CID 71323655
N-(5-diphenoxyphosphorylpentyl)benzamide (PubChem CID 71323655) has the molecular formula C24H26NO4P and a molecular weight of 423.45 g/mol. Its IUPAC name is N-(5-diphenoxyphosphorylpentyl)benzamide.
| Compound Name | N-(5-diphenoxyphosphorylpentyl)benzamide |
|---|---|
| PubChem CID | 71323655 |
| Molecular Formula | C24H26NO4P |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-(5-diphenoxyphosphorylpentyl)benzamide |
| SMILES | O=C(NCCCCCP(=O)(Oc1ccccc1)Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26NO4P/c26-24(21-13-5-1-6-14-21)25-19-11-4-12-20-30(27,28-22-15-7-2-8-16-22)29-23-17-9-3-10-18-23/h1-3,5-10,13-18H,4,11-12,19-20H2,(H,25,26) |
| InChIKey | IYZKHFAAAUGACH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|