C13H16N2OSe — CID 141484233
5-benzamidopentyl selenocyanate (PubChem CID 141484233) has the molecular formula C13H16N2OSe and a molecular weight of 295.24 g/mol. Its IUPAC name is 5-benzamidopentyl selenocyanate.
| Compound Name | 5-benzamidopentyl selenocyanate |
|---|---|
| PubChem CID | 141484233 |
| Molecular Formula | C13H16N2OSe |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 5-benzamidopentyl selenocyanate |
| SMILES | N#C[Se]CCCCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16N2OSe/c14-11-17-10-6-2-5-9-15-13(16)12-7-3-1-4-8-12/h1,3-4,7-8H,2,5-6,9-10H2,(H,15,16) |
| InChIKey | TYDQKSOQOXFEDB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|