About 3-benzamidopropyl sulfite
3-benzamidopropyl sulfite (PubChem CID 174467673) has the molecular formula C10H12NO4S-
and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-benzamidopropyl sulfite.
Molecular Properties
| Compound Name | 3-benzamidopropyl sulfite |
| PubChem CID | 174467673 |
| Molecular Formula | C10H12NO4S- |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 3-benzamidopropyl sulfite |
| SMILES | O=C(NCCCOS(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C10H13NO4S/c12-10(9-5-2-1-3-6-9)11-7-4-8-15-16(13)14/h1-3,5-6H,4,7-8H2,(H,11,12)(H,13,14)/p-1 |
| InChIKey | OHYNAUHWHGWRAC-UHFFFAOYSA-M |
| XLogP | 0.62 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-benzamidopropyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzamidopropyl sulfite?
The IUPAC name of 3-benzamidopropyl sulfite (CID 174467673) is 3-benzamidopropyl sulfite.
What is the SMILES notation for 3-benzamidopropyl sulfite?
The canonical SMILES for 3-benzamidopropyl sulfite is O=C(NCCCOS(=O)[O-])c1ccccc1.
What is the InChIKey of 3-benzamidopropyl sulfite?
The InChIKey is OHYNAUHWHGWRAC-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H13NO4S/c12-10(9-5-2-1-3-6-9)11-7-4-8-15-16(13)14/h1-3,5-6H,4,7-8H2,(H,11,12)(H,13,14)/p-1.
What are the key properties of 3-benzamidopropyl sulfite?
3-benzamidopropyl sulfite has a molecular weight of 242.28 g/mol, XLogP of 0.62, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzamidopropyl sulfite is sourced from PubChem (CID 174467673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).