About benzamido sulfite
benzamido sulfite (PubChem CID 57230748) has the molecular formula C7H6NO4S-
and a molecular weight of 200.20 g/mol. Its IUPAC name is benzamido sulfite.
Molecular Properties
| Compound Name | benzamido sulfite |
| PubChem CID | 57230748 |
| Molecular Formula | C7H6NO4S- |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | benzamido sulfite |
| SMILES | O=C(NOS(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C7H7NO4S/c9-7(8-12-13(10)11)6-4-2-1-3-5-6/h1-5H,(H,8,9)(H,10,11)/p-1 |
| InChIKey | ZWNDNBVTELULOG-UHFFFAOYSA-M |
| XLogP | 0.14 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze benzamido sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamido sulfite?
The IUPAC name of benzamido sulfite (CID 57230748) is benzamido sulfite.
What is the SMILES notation for benzamido sulfite?
The canonical SMILES for benzamido sulfite is O=C(NOS(=O)[O-])c1ccccc1.
What is the InChIKey of benzamido sulfite?
The InChIKey is ZWNDNBVTELULOG-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7NO4S/c9-7(8-12-13(10)11)6-4-2-1-3-5-6/h1-5H,(H,8,9)(H,10,11)/p-1.
What are the key properties of benzamido sulfite?
benzamido sulfite has a molecular weight of 200.20 g/mol, XLogP of 0.14, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzamido sulfite is sourced from PubChem (CID 57230748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).